About 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile
5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile (PubChem CID 166337030) has the molecular formula C21H19N3O4S
and a molecular weight of 409.47 g/mol. Its IUPAC name is 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile.
Molecular Properties
| Compound Name | 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile |
| PubChem CID | 166337030 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile |
| SMILES | CSc1ccc(Cn2c(=O)[nH]c3ccc(OC4CCOC4)cc3c2=O)cc1C#N |
| InChI | InChI=1S/C21H19N3O4S/c1-29-19-5-2-13(8-14(19)10-22)11-24-20(25)17-9-15(28-16-6-7-27-12-16)3-4-18(17)23-21(24)26/h2-5,8-9,16H,6-7,11-12H2,1H3,(H,23,26) |
| InChIKey | PFSJRSKKGVQISO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile?
The IUPAC name of 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile (CID 166337030) is 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile.
What is the SMILES notation for 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile?
The canonical SMILES for 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile is CSc1ccc(Cn2c(=O)[nH]c3ccc(OC4CCOC4)cc3c2=O)cc1C#N.
What is the InChIKey of 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile?
The InChIKey is PFSJRSKKGVQISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4S/c1-29-19-5-2-13(8-14(19)10-22)11-24-20(25)17-9-15(28-16-6-7-27-12-16)3-4-18(17)23-21(24)26/h2-5,8-9,16H,6-7,11-12H2,1H3,(H,23,26).
What are the key properties of 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile?
5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile has a molecular weight of 409.47 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2,4-dioxo-6-(oxolan-3-yloxy)-1H-quinazolin-3-yl]methyl]-2-methylsulfanylbenzonitrile is sourced from PubChem (CID 166337030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).