About N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide
N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide (PubChem CID 166340067) has the molecular formula C15H13F3N2O2S2
and a molecular weight of 374.41 g/mol. Its IUPAC name is N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide |
| PubChem CID | 166340067 |
| Molecular Formula | C15H13F3N2O2S2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1ccc2cc(OC(F)(F)F)ccc2n1)C1CSCCS1 |
| InChI | InChI=1S/C15H13F3N2O2S2/c16-15(17,18)22-10-2-3-11-9(7-10)1-4-13(19-11)20-14(21)12-8-23-5-6-24-12/h1-4,7,12H,5-6,8H2,(H,19,20,21) |
| InChIKey | VWZKBIQKWVKNMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide?
The IUPAC name of N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide (CID 166340067) is N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide.
What is the SMILES notation for N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide?
The canonical SMILES for N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide is O=C(Nc1ccc2cc(OC(F)(F)F)ccc2n1)C1CSCCS1.
What is the InChIKey of N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide?
The InChIKey is VWZKBIQKWVKNMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O2S2/c16-15(17,18)22-10-2-3-11-9(7-10)1-4-13(19-11)20-14(21)12-8-23-5-6-24-12/h1-4,7,12H,5-6,8H2,(H,19,20,21).
What are the key properties of N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide?
N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide has a molecular weight of 374.41 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(trifluoromethoxy)quinolin-2-yl]-1,4-dithiane-2-carboxamide is sourced from PubChem (CID 166340067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).