About methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate
methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate (PubChem CID 166341011) has the molecular formula C16H10Cl2F2N2O2S
and a molecular weight of 403.24 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate |
| PubChem CID | 166341011 |
| Molecular Formula | C16H10Cl2F2N2O2S |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate |
| SMILES | COC(=O)C(Sc1nc2cc(F)c(F)cc2[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl2F2N2O2S/c1-24-15(23)14(8-3-2-7(17)4-9(8)18)25-16-21-12-5-10(19)11(20)6-13(12)22-16/h2-6,14H,1H3,(H,21,22) |
| InChIKey | JICNEQUEPJZPRG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate?
The IUPAC name of methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate (CID 166341011) is methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate?
The canonical SMILES for methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate is COC(=O)C(Sc1nc2cc(F)c(F)cc2[nH]1)c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate?
The InChIKey is JICNEQUEPJZPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2F2N2O2S/c1-24-15(23)14(8-3-2-7(17)4-9(8)18)25-16-21-12-5-10(19)11(20)6-13(12)22-16/h2-6,14H,1H3,(H,21,22).
What are the key properties of methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate?
methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate has a molecular weight of 403.24 g/mol, XLogP of 5.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dichlorophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetate is sourced from PubChem (CID 166341011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).