C22H16Cl2F2N2O2 — CID 166341226
2-amino-N-[(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]-3,4-difluorobenzamide (PubChem CID 166341226) has the molecular formula C22H16Cl2F2N2O2 and a molecular weight of 449.28 g/mol. Its IUPAC name is 2-amino-N-[(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]-3,4-difluorobenzamide.
| Compound Name | 2-amino-N-[(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 166341226 |
| Molecular Formula | C22H16Cl2F2N2O2 |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-amino-N-[(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]-3,4-difluorobenzamide |
| SMILES | Nc1c(C(=O)NC(c2ccc3c(c2)CCO3)c2cc(Cl)ccc2Cl)ccc(F)c1F |
| InChI | InChI=1S/C22H16Cl2F2N2O2/c23-13-2-4-16(24)15(10-13)21(12-1-6-18-11(9-12)7-8-30-18)28-22(29)14-3-5-17(25)19(26)20(14)27/h1-6,9-10,21H,7-8,27H2,(H,28,29) |
| InChIKey | VRWVDDDCZPBYCA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|