C18H19BrN4O3S — CID 166341373
5-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-6-bromo-1,3-dimethylbenzimidazol-2-one (PubChem CID 166341373) has the molecular formula C18H19BrN4O3S and a molecular weight of 451.35 g/mol. Its IUPAC name is 5-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-6-bromo-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-6-bromo-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 166341373 |
| Molecular Formula | C18H19BrN4O3S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 5-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-6-bromo-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)N3CCCc4c(N)cccc43)c(Br)cc21 |
| InChI | InChI=1S/C18H19BrN4O3S/c1-21-15-9-12(19)17(10-16(15)22(2)18(21)24)27(25,26)23-8-4-5-11-13(20)6-3-7-14(11)23/h3,6-7,9-10H,4-5,8,20H2,1-2H3 |
| InChIKey | VVWKQIKQQSLEGR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|