About N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide
N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 166341396) has the molecular formula C15H15BrN4O5S
and a molecular weight of 443.28 g/mol. Its IUPAC name is N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 166341396 |
| Molecular Formula | C15H15BrN4O5S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1nocc1C(=O)NS(=O)(=O)c1cc2c(cc1Br)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H15BrN4O5S/c1-4-10-8(7-25-17-10)14(21)18-26(23,24)13-6-12-11(5-9(13)16)19(2)15(22)20(12)3/h5-7H,4H2,1-3H3,(H,18,21) |
| InChIKey | GXTWEYAWUGFQJI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide (CID 166341396) is N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide is CCc1nocc1C(=O)NS(=O)(=O)c1cc2c(cc1Br)n(C)c(=O)n2C.
What is the InChIKey of N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide?
The InChIKey is GXTWEYAWUGFQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrN4O5S/c1-4-10-8(7-25-17-10)14(21)18-26(23,24)13-6-12-11(5-9(13)16)19(2)15(22)20(12)3/h5-7H,4H2,1-3H3,(H,18,21).
What are the key properties of N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide?
N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide has a molecular weight of 443.28 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonyl-3-ethyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 166341396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).