About 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone
1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 166341923) has the molecular formula C16H19ClN6O
and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| PubChem CID | 166341923 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCN(C2CCc3c(Cl)cccc32)CC1 |
| InChI | InChI=1S/C16H19ClN6O/c17-14-3-1-2-13-12(14)4-5-15(13)21-6-8-22(9-7-21)16(24)10-23-11-18-19-20-23/h1-3,11,15H,4-10H2 |
| InChIKey | LSGBWLGYHYSWHW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone?
The IUPAC name of 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (CID 166341923) is 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
What is the SMILES notation for 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone?
The canonical SMILES for 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone is O=C(Cn1cnnn1)N1CCN(C2CCc3c(Cl)cccc32)CC1.
What is the InChIKey of 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone?
The InChIKey is LSGBWLGYHYSWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN6O/c17-14-3-1-2-13-12(14)4-5-15(13)21-6-8-22(9-7-21)16(24)10-23-11-18-19-20-23/h1-3,11,15H,4-10H2.
What are the key properties of 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone?
1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone has a molecular weight of 346.82 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-chloro-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone is sourced from PubChem (CID 166341923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).