C18H15ClN2O2 — CID 166342350
3-[2-(4-chlorophenyl)ethylamino]-1-phenylpyrrole-2,5-dione (PubChem CID 166342350) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)ethylamino]-1-phenylpyrrole-2,5-dione.
| Compound Name | 3-[2-(4-chlorophenyl)ethylamino]-1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 166342350 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-[2-(4-chlorophenyl)ethylamino]-1-phenylpyrrole-2,5-dione |
| SMILES | O=C1C=C(NCCc2ccc(Cl)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O2/c19-14-8-6-13(7-9-14)10-11-20-16-12-17(22)21(18(16)23)15-4-2-1-3-5-15/h1-9,12,20H,10-11H2 |
| InChIKey | HFCXOSJGSUTTJC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|