C30H37BrF2N6O2 — CID 166344050
[5-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]-2,2-dimethylpiperidin-1-yl]-[2-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]methanone (PubChem CID 166344050) has the molecular formula C30H37BrF2N6O2 and a molecular weight of 631.57 g/mol. Its IUPAC name is [5-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]-2,2-dimethylpiperidin-1-yl]-[2-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]methanone.
| Compound Name | [5-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]-2,2-dimethylpiperidin-1-yl]-[2-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 166344050 |
| Molecular Formula | C30H37BrF2N6O2 |
| Molecular Weight | 631.57 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | [5-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]-2,2-dimethylpiperidin-1-yl]-[2-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]methanone |
| SMILES | CC1CCCCN1CCOc1ccccc1C(=O)N1CC(n2cc(-c3cc(F)c(Br)c(F)c3N)nn2)CCC1(C)C |
| InChI | InChI=1S/C30H37BrF2N6O2/c1-19-8-6-7-13-37(19)14-15-41-25-10-5-4-9-21(25)29(40)38-17-20(11-12-30(38,2)3)39-18-24(35-36-39)22-16-23(32)26(31)27(33)28(22)34/h4-5,9-10,16,18-20H,6-8,11-15,17,34H2,1-3H3 |
| InChIKey | BFVSQGYCJFVMQY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|