C33H34F3N5O3 — CID 166344220
2-benzyl-4-[2,2-dimethyl-5-[4-[3-(trifluoromethyl)phenyl]triazol-1-yl]piperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 166344220) has the molecular formula C33H34F3N5O3 and a molecular weight of 605.66 g/mol. Its IUPAC name is 2-benzyl-4-[2,2-dimethyl-5-[4-[3-(trifluoromethyl)phenyl]triazol-1-yl]piperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4-[2,2-dimethyl-5-[4-[3-(trifluoromethyl)phenyl]triazol-1-yl]piperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 166344220 |
| Molecular Formula | C33H34F3N5O3 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-benzyl-4-[2,2-dimethyl-5-[4-[3-(trifluoromethyl)phenyl]triazol-1-yl]piperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1C=CC2C(=O)N(Cc3ccccc3)C(=O)C2C1C(=O)N1CC(n2cc(-c3cccc(C(F)(F)F)c3)nn2)CCC1(C)C |
| InChI | InChI=1S/C33H34F3N5O3/c1-20-12-13-25-28(30(43)39(29(25)42)17-21-8-5-4-6-9-21)27(20)31(44)40-18-24(14-15-32(40,2)3)41-19-26(37-38-41)22-10-7-11-23(16-22)33(34,35)36/h4-13,16,19-20,24-25,27-28H,14-15,17-18H2,1-3H3 |
| InChIKey | NMMVYOOGYRHDOR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|