C33H35BrFN5O3 — CID 166344269
2-benzyl-4-[4-[1-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]triazol-4-yl]-2-methylpiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 166344269) has the molecular formula C33H35BrFN5O3 and a molecular weight of 648.58 g/mol. Its IUPAC name is 2-benzyl-4-[4-[1-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]triazol-4-yl]-2-methylpiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4-[4-[1-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]triazol-4-yl]-2-methylpiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 166344269 |
| Molecular Formula | C33H35BrFN5O3 |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 647.19 |
| IUPAC Name | 2-benzyl-4-[4-[1-[(1S)-1-(4-bromo-2-fluorophenyl)ethyl]triazol-4-yl]-2-methylpiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1C=CC2C(=O)N(Cc3ccccc3)C(=O)C2C1C(=O)N1CCC(c2cn([C@@H](C)c3ccc(Br)cc3F)nn2)CC1C |
| InChI | InChI=1S/C33H35BrFN5O3/c1-19-9-11-26-30(33(43)39(31(26)41)17-22-7-5-4-6-8-22)29(19)32(42)38-14-13-23(15-20(38)2)28-18-40(37-36-28)21(3)25-12-10-24(34)16-27(25)35/h4-12,16,18-21,23,26,29-30H,13-15,17H2,1-3H3/t19?,20?,21-,23?,26?,29?,30?/m0/s1 |
| InChIKey | FOSIYNAEEBAURN-JRYYXWRTSA-N |
| XLogP | 5.51 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|