C29H29Cl3N6O4 — CID 166344519
5-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 166344519) has the molecular formula C29H29Cl3N6O4 and a molecular weight of 631.95 g/mol. Its IUPAC name is 5-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166344519 |
| Molecular Formula | C29H29Cl3N6O4 |
| Molecular Weight | 631.95 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | 5-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)C[C@H](C)N1Cc1cn(-c2c(Cl)cc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C29H29Cl3N6O4/c1-16-11-35(12-17(2)36(16)13-20-14-38(34-33-20)26-24(31)9-19(30)10-25(26)32)27(39)18-5-6-22-23(8-18)29(41)37(28(22)40)15-21-4-3-7-42-21/h5-6,8-10,14,16-17,21H,3-4,7,11-13,15H2,1-2H3/t16-,17+,21? |
| InChIKey | PZYXGJBLQIDCBF-QRTHJKPMSA-N |
| XLogP | 4.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|