C36H43FN6O3 — CID 166345092
2-benzyl-4-[(3S,5R)-4-[[1-[2-(4-fluorophenyl)butan-2-yl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 166345092) has the molecular formula C36H43FN6O3 and a molecular weight of 626.78 g/mol. Its IUPAC name is 2-benzyl-4-[(3S,5R)-4-[[1-[2-(4-fluorophenyl)butan-2-yl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4-[(3S,5R)-4-[[1-[2-(4-fluorophenyl)butan-2-yl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 166345092 |
| Molecular Formula | C36H43FN6O3 |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 2-benzyl-4-[(3S,5R)-4-[[1-[2-(4-fluorophenyl)butan-2-yl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC(C)(c1ccc(F)cc1)n1cc(CN2[C@H](C)CN(C(=O)C3C(C)C=CC4C(=O)N(Cc5ccccc5)C(=O)C43)C[C@@H]2C)nn1 |
| InChI | InChI=1S/C36H43FN6O3/c1-6-36(5,27-13-15-28(37)16-14-27)43-22-29(38-39-43)21-41-24(3)18-40(19-25(41)4)34(45)31-23(2)12-17-30-32(31)35(46)42(33(30)44)20-26-10-8-7-9-11-26/h7-17,22-25,30-32H,6,18-21H2,1-5H3/t23?,24-,25+,30?,31?,32?,36? |
| InChIKey | AIPWGQYDBBTLGW-DWKORPJHSA-N |
| XLogP | 4.64 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|