C42H49N5O4 — CID 166345356
[(4Z)-2-tert-butyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridin-9-yl]-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]methanone (PubChem CID 166345356) has the molecular formula C42H49N5O4 and a molecular weight of 687.89 g/mol. Its IUPAC name is [(4Z)-2-tert-butyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridin-9-yl]-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(4Z)-2-tert-butyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridin-9-yl]-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166345356 |
| Molecular Formula | C42H49N5O4 |
| Molecular Weight | 687.89 g/mol |
| Exact Mass | 687.38 |
| IUPAC Name | [(4Z)-2-tert-butyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridin-9-yl]-[4-[(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1cc(/C=C2/CC(C(C)(C)C)Cc3c2nc2ccccc2c3C(=O)N2CCN(Cc3c(C)nc4cc(C)ccn34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C42H49N5O4/c1-26-13-14-47-34(27(2)43-37(47)19-26)25-45-15-17-46(18-16-45)41(48)38-31-11-9-10-12-33(31)44-39-29(23-30(24-32(38)39)42(3,4)5)20-28-21-35(49-6)40(51-8)36(22-28)50-7/h9-14,19-22,30H,15-18,23-25H2,1-8H3/b29-20- |
| InChIKey | YSDVLQJZNLTRGG-BRPDVVIDSA-N |
| XLogP | 7.63 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.89 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |