C32H27Cl2N5O5 — CID 166346480
3-[2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 166346480) has the molecular formula C32H27Cl2N5O5 and a molecular weight of 632.50 g/mol. Its IUPAC name is 3-[2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166346480 |
| Molecular Formula | C32H27Cl2N5O5 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 3-[2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)NC(=O)N(CC(=O)N2N=C3/C(=C\c4ccc(Cl)cc4)CCCC3C2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C32H27Cl2N5O5/c1-32(22-5-3-6-25(17-22)39(43)44)30(41)37(31(42)35-32)18-27(40)38-29(20-10-14-24(34)15-11-20)26-7-2-4-21(28(26)36-38)16-19-8-12-23(33)13-9-19/h3,5-6,8-17,26,29H,2,4,7,18H2,1H3,(H,35,42)/b21-16- |
| InChIKey | KZLNMJDFFSLZFV-PGMHBOJBSA-N |
| XLogP | 6.49 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|