C29H31Cl3N6O3 — CID 166347310
2-[4-methyl-1-oxo-1-[4-[2-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-2-yl]piperazin-1-yl]pentan-2-yl]isoindole-1,3-dione (PubChem CID 166347310) has the molecular formula C29H31Cl3N6O3 and a molecular weight of 617.97 g/mol. Its IUPAC name is 2-[4-methyl-1-oxo-1-[4-[2-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-2-yl]piperazin-1-yl]pentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-methyl-1-oxo-1-[4-[2-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-2-yl]piperazin-1-yl]pentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166347310 |
| Molecular Formula | C29H31Cl3N6O3 |
| Molecular Weight | 617.97 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-[4-methyl-1-oxo-1-[4-[2-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-2-yl]piperazin-1-yl]pentan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)CC(C(=O)N1CCN(C(C)(C)c2cn(-c3cc(Cl)c(Cl)cc3Cl)nn2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H31Cl3N6O3/c1-17(2)13-24(38-26(39)18-7-5-6-8-19(18)27(38)40)28(41)35-9-11-36(12-10-35)29(3,4)25-16-37(34-33-25)23-15-21(31)20(30)14-22(23)32/h5-8,14-17,24H,9-13H2,1-4H3 |
| InChIKey | WYGPYVOCKGFCGE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|