C24H25N3O — CID 166349170
1-benzyl-3-[methyl-[(4-pyridin-4-ylphenyl)methyl]amino]pyrrolidin-2-one (PubChem CID 166349170) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-benzyl-3-[methyl-[(4-pyridin-4-ylphenyl)methyl]amino]pyrrolidin-2-one.
| Compound Name | 1-benzyl-3-[methyl-[(4-pyridin-4-ylphenyl)methyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166349170 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-benzyl-3-[methyl-[(4-pyridin-4-ylphenyl)methyl]amino]pyrrolidin-2-one |
| SMILES | CN(Cc1ccc(-c2ccncc2)cc1)C1CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H25N3O/c1-26(17-20-7-9-21(10-8-20)22-11-14-25-15-12-22)23-13-16-27(24(23)28)18-19-5-3-2-4-6-19/h2-12,14-15,23H,13,16-18H2,1H3 |
| InChIKey | DZWYOOMCUKXZTB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |