C13H11ClF2N4O2 — CID 166349854
1-(3-chloro-2,5-difluorophenyl)-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea (PubChem CID 166349854) has the molecular formula C13H11ClF2N4O2 and a molecular weight of 328.71 g/mol. Its IUPAC name is 1-(3-chloro-2,5-difluorophenyl)-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea.
| Compound Name | 1-(3-chloro-2,5-difluorophenyl)-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 166349854 |
| Molecular Formula | C13H11ClF2N4O2 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 1-(3-chloro-2,5-difluorophenyl)-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1F)Nc1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C13H11ClF2N4O2/c14-8-3-6(15)4-10(11(8)16)17-13(21)18-12-7-5-22-2-1-9(7)19-20-12/h3-4H,1-2,5H2,(H3,17,18,19,20,21) |
| InChIKey | IZPBVKVGCPRQSX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|