About 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one
5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one (PubChem CID 166350017) has the molecular formula C15H19ClN4O2
and a molecular weight of 322.80 g/mol. Its IUPAC name is 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one |
| PubChem CID | 166350017 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one |
| SMILES | CO[C@@H]1CCCC[C@H]1n1cc(Cn2cc(Cl)ccc2=O)nn1 |
| InChI | InChI=1S/C15H19ClN4O2/c1-22-14-5-3-2-4-13(14)20-10-12(17-18-20)9-19-8-11(16)6-7-15(19)21/h6-8,10,13-14H,2-5,9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | HPLJIBWXKBLRMQ-ZIAGYGMSSA-N |
| XLogP | 2.27 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one?
The IUPAC name of 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one (CID 166350017) is 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one.
What is the SMILES notation for 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one?
The canonical SMILES for 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one is CO[C@@H]1CCCC[C@H]1n1cc(Cn2cc(Cl)ccc2=O)nn1.
What is the InChIKey of 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one?
The InChIKey is HPLJIBWXKBLRMQ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H19ClN4O2/c1-22-14-5-3-2-4-13(14)20-10-12(17-18-20)9-19-8-11(16)6-7-15(19)21/h6-8,10,13-14H,2-5,9H2,1H3/t13-,14-/m1/s1.
What are the key properties of 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one?
5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one has a molecular weight of 322.80 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[[1-[(1R,2R)-2-methoxycyclohexyl]triazol-4-yl]methyl]pyridin-2-one is sourced from PubChem (CID 166350017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).