About 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol
4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol (PubChem CID 166350058) has the molecular formula C16H23Cl2NO
and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol |
| PubChem CID | 166350058 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol |
| SMILES | CN(CCCCO)C1CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-19(9-2-3-10-20)16-6-4-5-13(16)12-7-8-14(17)15(18)11-12/h7-8,11,13,16,20H,2-6,9-10H2,1H3 |
| InChIKey | BYECFNGSTFQMFK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol?
The IUPAC name of 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol (CID 166350058) is 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol.
What is the SMILES notation for 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol?
The canonical SMILES for 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol is CN(CCCCO)C1CCCC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol?
The InChIKey is BYECFNGSTFQMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2NO/c1-19(9-2-3-10-20)16-6-4-5-13(16)12-7-8-14(17)15(18)11-12/h7-8,11,13,16,20H,2-6,9-10H2,1H3.
What are the key properties of 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol?
4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol has a molecular weight of 316.27 g/mol, XLogP of 4.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dichlorophenyl)cyclopentyl]-methylamino]butan-1-ol is sourced from PubChem (CID 166350058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).