C14H17N5O4 — CID 166350686
N-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide (PubChem CID 166350686) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide.
| Compound Name | N-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166350686 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H](CO)[C@H](O)[C@@H]1O)c1ccnc(-n2cncn2)c1 |
| InChI | InChI=1S/C14H17N5O4/c20-5-9-3-10(13(22)12(9)21)18-14(23)8-1-2-16-11(4-8)19-7-15-6-17-19/h1-2,4,6-7,9-10,12-13,20-22H,3,5H2,(H,18,23)/t9-,10-,12-,13+/m0/s1 |
| InChIKey | CMGAWCDDJJCEFZ-XRRVDJEJSA-N |
| XLogP | -1.51 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |