C23H33NO — CID 166351014
1-(naphthalen-2-ylmethylamino)-2-(4-propan-2-ylcyclohexyl)propan-2-ol (PubChem CID 166351014) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-(naphthalen-2-ylmethylamino)-2-(4-propan-2-ylcyclohexyl)propan-2-ol.
| Compound Name | 1-(naphthalen-2-ylmethylamino)-2-(4-propan-2-ylcyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 166351014 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 1-(naphthalen-2-ylmethylamino)-2-(4-propan-2-ylcyclohexyl)propan-2-ol |
| SMILES | CC(C)C1CCC(C(C)(O)CNCc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H33NO/c1-17(2)19-10-12-22(13-11-19)23(3,25)16-24-15-18-8-9-20-6-4-5-7-21(20)14-18/h4-9,14,17,19,22,24-25H,10-13,15-16H2,1-3H3 |
| InChIKey | OERXWKGPQRVWHX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |