C17H24BrN3O2S — CID 166351098
4-bromo-2,6-dimethyl-N-(5-methyl-2-pentylpyrazol-3-yl)benzenesulfonamide (PubChem CID 166351098) has the molecular formula C17H24BrN3O2S and a molecular weight of 414.37 g/mol. Its IUPAC name is 4-bromo-2,6-dimethyl-N-(5-methyl-2-pentylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dimethyl-N-(5-methyl-2-pentylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 166351098 |
| Molecular Formula | C17H24BrN3O2S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 4-bromo-2,6-dimethyl-N-(5-methyl-2-pentylpyrazol-3-yl)benzenesulfonamide |
| SMILES | CCCCCn1nc(C)cc1NS(=O)(=O)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C17H24BrN3O2S/c1-5-6-7-8-21-16(11-14(4)19-21)20-24(22,23)17-12(2)9-15(18)10-13(17)3/h9-11,20H,5-8H2,1-4H3 |
| InChIKey | OWNSOBBCTQRINP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|