C25H23Br2ClN2O4 — CID 166352714
N-[[4-bromo-2-(3-chlorophenoxy)phenyl]methyl]-N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N,N'-dimethyloxamide (PubChem CID 166352714) has the molecular formula C25H23Br2ClN2O4 and a molecular weight of 610.73 g/mol. Its IUPAC name is N-[[4-bromo-2-(3-chlorophenoxy)phenyl]methyl]-N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N,N'-dimethyloxamide.
| Compound Name | N-[[4-bromo-2-(3-chlorophenoxy)phenyl]methyl]-N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N,N'-dimethyloxamide |
|---|---|
| PubChem CID | 166352714 |
| Molecular Formula | C25H23Br2ClN2O4 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 607.97 |
| IUPAC Name | N-[[4-bromo-2-(3-chlorophenoxy)phenyl]methyl]-N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N,N'-dimethyloxamide |
| SMILES | CN(Cc1ccc(Br)cc1Oc1cccc(Cl)c1)C(=O)C(=O)N(C)CC(O)c1ccccc1Br |
| InChI | InChI=1S/C25H23Br2ClN2O4/c1-29(24(32)25(33)30(2)15-22(31)20-8-3-4-9-21(20)27)14-16-10-11-17(26)12-23(16)34-19-7-5-6-18(28)13-19/h3-13,22,31H,14-15H2,1-2H3 |
| InChIKey | VNHTUEPQKRUXGO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|