C31H40Cl3N5O2 — CID 166352890
2-(2,4-ditert-butylphenoxy)-1-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 166352890) has the molecular formula C31H40Cl3N5O2 and a molecular weight of 621.05 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenoxy)-1-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-ditert-butylphenoxy)-1-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 166352890 |
| Molecular Formula | C31H40Cl3N5O2 |
| Molecular Weight | 621.05 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 2-(2,4-ditert-butylphenoxy)-1-[(3R,5S)-3,5-dimethyl-4-[[1-(2,4,6-trichlorophenyl)triazol-4-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)C[C@H](C)N1Cc1cn(-c2c(Cl)cc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C31H40Cl3N5O2/c1-19-14-37(28(40)18-41-27-10-9-21(30(3,4)5)11-24(27)31(6,7)8)15-20(2)38(19)16-23-17-39(36-35-23)29-25(33)12-22(32)13-26(29)34/h9-13,17,19-20H,14-16,18H2,1-8H3/t19-,20+ |
| InChIKey | MEVKQZLMANCIKR-BGYRXZFFSA-N |
| XLogP | 7.32 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.05 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |