C18H26N2O2 — CID 166354928
cis-(1R,3S)-1-amino-3-hydroxy-2,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclobutane-1-carboxamide (PubChem CID 166354928) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is cis-(1R,3S)-1-amino-3-hydroxy-2,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclobutane-1-carboxamide.
| Compound Name | cis-(1R,3S)-1-amino-3-hydroxy-2,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 166354928 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | cis-(1R,3S)-1-amino-3-hydroxy-2,2-dimethyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclobutane-1-carboxamide |
| SMILES | CC1(C)[C@@H](O)C[C@]1(N)C(=O)NCC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2)15(21)10-18(17,19)16(22)20-11-13-8-5-7-12-6-3-4-9-14(12)13/h3-4,6,9,13,15,21H,5,7-8,10-11,19H2,1-2H3,(H,20,22)/t13?,15-,18-/m0/s1 |
| InChIKey | ICGVMRVYWDESRD-ARJFZQPCSA-N |
| XLogP | 1.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |