About 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide
6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide (PubChem CID 166355458) has the molecular formula C12H10BrN5O2
and a molecular weight of 336.15 g/mol. Its IUPAC name is 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide |
| PubChem CID | 166355458 |
| Molecular Formula | C12H10BrN5O2 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide |
| SMILES | O=C(NCCc1cnoc1)c1cc(Br)cc2n[nH]nc12 |
| InChI | InChI=1S/C12H10BrN5O2/c13-8-3-9(11-10(4-8)16-18-17-11)12(19)14-2-1-7-5-15-20-6-7/h3-6H,1-2H2,(H,14,19)(H,16,17,18) |
| InChIKey | FBLOPHLXLAMLMA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide?
The IUPAC name of 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide (CID 166355458) is 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide.
What is the SMILES notation for 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide?
The canonical SMILES for 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide is O=C(NCCc1cnoc1)c1cc(Br)cc2n[nH]nc12.
What is the InChIKey of 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide?
The InChIKey is FBLOPHLXLAMLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN5O2/c13-8-3-9(11-10(4-8)16-18-17-11)12(19)14-2-1-7-5-15-20-6-7/h3-6H,1-2H2,(H,14,19)(H,16,17,18).
What are the key properties of 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide?
6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide has a molecular weight of 336.15 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[2-(1,2-oxazol-4-yl)ethyl]-2H-benzotriazole-4-carboxamide is sourced from PubChem (CID 166355458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).