C26H27N7O6 — CID 166356247
2-[4-[[1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyrrolidin-2-yl]methyl]triazol-1-yl]-N-phenylpropanamide (PubChem CID 166356247) has the molecular formula C26H27N7O6 and a molecular weight of 533.55 g/mol. Its IUPAC name is 2-[4-[[1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyrrolidin-2-yl]methyl]triazol-1-yl]-N-phenylpropanamide.
| Compound Name | 2-[4-[[1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyrrolidin-2-yl]methyl]triazol-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 166356247 |
| Molecular Formula | C26H27N7O6 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-[4-[[1-[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyrrolidin-2-yl]methyl]triazol-1-yl]-N-phenylpropanamide |
| SMILES | CC(C(=O)Nc1ccccc1)n1cc(CC2CCCN2C(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)nn1 |
| InChI | InChI=1S/C26H27N7O6/c1-17(26(36)27-18-6-3-2-4-7-18)32-14-19(28-29-32)12-20-8-5-11-30(20)24(34)15-31-22-13-21(33(37)38)9-10-23(22)39-16-25(31)35/h2-4,6-7,9-10,13-14,17,20H,5,8,11-12,15-16H2,1H3,(H,27,36) |
| InChIKey | QSNVTSYFJAWGRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|