C16H17F3N2O4 — CID 166356632
2-[[1H-indol-4-ylmethyl(methyl)amino]methyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166356632) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-[[1H-indol-4-ylmethyl(methyl)amino]methyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[1H-indol-4-ylmethyl(methyl)amino]methyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166356632 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[[1H-indol-4-ylmethyl(methyl)amino]methyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=C(CN(C)Cc1cccc2[nH]ccc12)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H16N2O2.C2HF3O2/c1-10(14(17)18)8-16(2)9-11-4-3-5-13-12(11)6-7-15-13;3-2(4,5)1(6)7/h3-7,15H,1,8-9H2,2H3,(H,17,18);(H,6,7) |
| InChIKey | YCCYJSQMUUFCKW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|