About [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate
[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate (PubChem CID 166357080) has the molecular formula C24H16FNO4
and a molecular weight of 401.39 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate.
Molecular Properties
| Compound Name | [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate |
| PubChem CID | 166357080 |
| Molecular Formula | C24H16FNO4 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate |
| SMILES | O=C(Cc1cc2c(ccc3ccccc32)o1)OCc1coc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C24H16FNO4/c25-21-8-4-3-7-19(21)24-26-16(14-29-24)13-28-23(27)12-17-11-20-18-6-2-1-5-15(18)9-10-22(20)30-17/h1-11,14H,12-13H2 |
| InChIKey | KKNLBKSRKJFKLP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate?
The IUPAC name of [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate (CID 166357080) is [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate.
What is the SMILES notation for [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate?
The canonical SMILES for [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate is O=C(Cc1cc2c(ccc3ccccc32)o1)OCc1coc(-c2ccccc2F)n1.
What is the InChIKey of [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate?
The InChIKey is KKNLBKSRKJFKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16FNO4/c25-21-8-4-3-7-19(21)24-26-16(14-29-24)13-28-23(27)12-17-11-20-18-6-2-1-5-15(18)9-10-22(20)30-17/h1-11,14H,12-13H2.
What are the key properties of [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate?
[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate has a molecular weight of 401.39 g/mol, XLogP of 5.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl 2-benzo[e][1]benzofuran-2-ylacetate is sourced from PubChem (CID 166357080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).