About 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile
2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile (PubChem CID 166357431) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile |
| PubChem CID | 166357431 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile |
| SMILES | Cc1ccc2c(c1)N(S(=O)(=O)Cc1ccc(CC#N)cc1)CCO2 |
| InChI | InChI=1S/C18H18N2O3S/c1-14-2-7-18-17(12-14)20(10-11-23-18)24(21,22)13-16-5-3-15(4-6-16)8-9-19/h2-7,12H,8,10-11,13H2,1H3 |
| InChIKey | SJIGDZFFDRVLJL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile?
The IUPAC name of 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile (CID 166357431) is 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile.
What is the SMILES notation for 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile?
The canonical SMILES for 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile is Cc1ccc2c(c1)N(S(=O)(=O)Cc1ccc(CC#N)cc1)CCO2.
What is the InChIKey of 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile?
The InChIKey is SJIGDZFFDRVLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S/c1-14-2-7-18-17(12-14)20(10-11-23-18)24(21,22)13-16-5-3-15(4-6-16)8-9-19/h2-7,12H,8,10-11,13H2,1H3.
What are the key properties of 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile?
2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile has a molecular weight of 342.42 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonylmethyl]phenyl]acetonitrile is sourced from PubChem (CID 166357431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).