About methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate
methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate (PubChem CID 166357642) has the molecular formula C16H17Cl2NO6S2
and a molecular weight of 454.35 g/mol. Its IUPAC name is methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate |
| PubChem CID | 166357642 |
| Molecular Formula | C16H17Cl2NO6S2 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)NC(CCO)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C16H17Cl2NO6S2/c1-24-13-8-14(15(21)25-2)26-16(13)27(22,23)19-12(5-6-20)9-3-4-10(17)11(18)7-9/h3-4,7-8,12,19-20H,5-6H2,1-2H3 |
| InChIKey | JEMUNBRUJYXNGB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate?
The IUPAC name of methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate (CID 166357642) is methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate is COC(=O)c1cc(OC)c(S(=O)(=O)NC(CCO)c2ccc(Cl)c(Cl)c2)s1.
What is the InChIKey of methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate?
The InChIKey is JEMUNBRUJYXNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2NO6S2/c1-24-13-8-14(15(21)25-2)26-16(13)27(22,23)19-12(5-6-20)9-3-4-10(17)11(18)7-9/h3-4,7-8,12,19-20H,5-6H2,1-2H3.
What are the key properties of methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate?
methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate has a molecular weight of 454.35 g/mol, XLogP of 3.25, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[1-(3,4-dichlorophenyl)-3-hydroxypropyl]sulfamoyl]-4-methoxythiophene-2-carboxylate is sourced from PubChem (CID 166357642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).