C29H22N4O3 — CID 166357701
3-[[3-(benzimidazol-1-ylmethyl)phenyl]methyl]-6-phenoxy-1H-quinazoline-2,4-dione (PubChem CID 166357701) has the molecular formula C29H22N4O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[[3-(benzimidazol-1-ylmethyl)phenyl]methyl]-6-phenoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-(benzimidazol-1-ylmethyl)phenyl]methyl]-6-phenoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166357701 |
| Molecular Formula | C29H22N4O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[[3-(benzimidazol-1-ylmethyl)phenyl]methyl]-6-phenoxy-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccc(Oc3ccccc3)cc2c(=O)n1Cc1cccc(Cn2cnc3ccccc32)c1 |
| InChI | InChI=1S/C29H22N4O3/c34-28-24-16-23(36-22-9-2-1-3-10-22)13-14-25(24)31-29(35)33(28)18-21-8-6-7-20(15-21)17-32-19-30-26-11-4-5-12-27(26)32/h1-16,19H,17-18H2,(H,31,35) |
| InChIKey | QZBNXWRHDGGCEH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |