[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate

C19H17ClN2O2 — CID 166359167

IUPAC[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate
SMILESC[C@H](OC(=O)c1cnn(Cc2ccccc2)c1Cl)c1ccccc1
InChIInChI=1S/C19H17ClN2O2/c1-14(16-10-6-3-7-11-16)24-19(23)17-12-21-22(18(17)20)13-15-8-4-2-5-9-15/h2-12,14H,13H2,1H3/t14-/m0/s1
InChIKeyQXKJYEJGAAUIOY-AWEZNQCLSA-N
MW340.81 g/mol
LogP4.50
Rot. Bonds5

About [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate

[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate (PubChem CID 166359167) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate.

Molecular Properties

Compound Name[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate
PubChem CID166359167
Molecular FormulaC19H17ClN2O2
Molecular Weight340.81 g/mol
Exact Mass340.10
IUPAC Name[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate
SMILESC[C@H](OC(=O)c1cnn(Cc2ccccc2)c1Cl)c1ccccc1
InChIInChI=1S/C19H17ClN2O2/c1-14(16-10-6-3-7-11-16)24-19(23)17-12-21-22(18(17)20)13-15-8-4-2-5-9-15/h2-12,14H,13H2,1H3/t14-/m0/s1
InChIKeyQXKJYEJGAAUIOY-AWEZNQCLSA-N
XLogP4.50
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.81
LogP ≤ 54.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate?
The IUPAC name of [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate (CID 166359167) is [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate.
What is the SMILES notation for [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate?
The canonical SMILES for [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate is C[C@H](OC(=O)c1cnn(Cc2ccccc2)c1Cl)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate?
The InChIKey is QXKJYEJGAAUIOY-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H17ClN2O2/c1-14(16-10-6-3-7-11-16)24-19(23)17-12-21-22(18(17)20)13-15-8-4-2-5-9-15/h2-12,14H,13H2,1H3/t14-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate?
[(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate has a molecular weight of 340.81 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] 1-benzyl-5-chloropyrazole-4-carboxylate is sourced from PubChem (CID 166359167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).