C18H19N3O — CID 166359746
4-(1,2-oxazol-3-yl)-N-(4-pyridin-3-ylbutan-2-yl)aniline (PubChem CID 166359746) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(1,2-oxazol-3-yl)-N-(4-pyridin-3-ylbutan-2-yl)aniline.
| Compound Name | 4-(1,2-oxazol-3-yl)-N-(4-pyridin-3-ylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 166359746 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-(1,2-oxazol-3-yl)-N-(4-pyridin-3-ylbutan-2-yl)aniline |
| SMILES | CC(CCc1cccnc1)Nc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C18H19N3O/c1-14(4-5-15-3-2-11-19-13-15)20-17-8-6-16(7-9-17)18-10-12-22-21-18/h2-3,6-14,20H,4-5H2,1H3 |
| InChIKey | GIABSHYMGBKBFI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |