C16H19Cl2N3O2 — CID 166360012
N-[(3aS,6aR)-5-acetamido-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3,5-dichloropyridine-4-carboxamide (PubChem CID 166360012) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-acetamido-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3,5-dichloropyridine-4-carboxamide.
| Compound Name | N-[(3aS,6aR)-5-acetamido-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 166360012 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(3aS,6aR)-5-acetamido-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3,5-dichloropyridine-4-carboxamide |
| SMILES | CC(=O)NC1C[C@@H]2CC(NC(=O)c3c(Cl)cncc3Cl)C[C@@H]2C1 |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-8(22)20-11-2-9-4-12(5-10(9)3-11)21-16(23)15-13(17)6-19-7-14(15)18/h6-7,9-12H,2-5H2,1H3,(H,20,22)(H,21,23)/t9-,10+,11?,12? |
| InChIKey | ITHFHZOLANLRCC-ZYANWLCNSA-N |
| XLogP | 2.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |