About (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate
(5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate (PubChem CID 166360199) has the molecular formula C17H16N2O2S
and a molecular weight of 312.39 g/mol. Its IUPAC name is (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate.
Molecular Properties
| Compound Name | (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate |
| PubChem CID | 166360199 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate |
| SMILES | Cc1cncc(COC(=O)CCc2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C17H16N2O2S/c1-12-6-14(9-18-8-12)10-21-17(20)5-3-13-2-4-15-16(7-13)22-11-19-15/h2,4,6-9,11H,3,5,10H2,1H3 |
| InChIKey | AOODKJMSUCXCBE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate?
The IUPAC name of (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate (CID 166360199) is (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate.
What is the SMILES notation for (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate?
The canonical SMILES for (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate is Cc1cncc(COC(=O)CCc2ccc3ncsc3c2)c1.
What is the InChIKey of (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate?
The InChIKey is AOODKJMSUCXCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S/c1-12-6-14(9-18-8-12)10-21-17(20)5-3-13-2-4-15-16(7-13)22-11-19-15/h2,4,6-9,11H,3,5,10H2,1H3.
What are the key properties of (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate?
(5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate has a molecular weight of 312.39 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-3-pyridinyl)methyl 3-(1,3-benzothiazol-6-yl)propanoate is sourced from PubChem (CID 166360199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).