C21H21N3O3 — CID 166360265
(4-imidazol-1-ylphenyl)methyl 1-(6-methoxy-3-pyridinyl)cyclobutane-1-carboxylate (PubChem CID 166360265) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is (4-imidazol-1-ylphenyl)methyl 1-(6-methoxy-3-pyridinyl)cyclobutane-1-carboxylate.
| Compound Name | (4-imidazol-1-ylphenyl)methyl 1-(6-methoxy-3-pyridinyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166360265 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (4-imidazol-1-ylphenyl)methyl 1-(6-methoxy-3-pyridinyl)cyclobutane-1-carboxylate |
| SMILES | COc1ccc(C2(C(=O)OCc3ccc(-n4ccnc4)cc3)CCC2)cn1 |
| InChI | InChI=1S/C21H21N3O3/c1-26-19-8-5-17(13-23-19)21(9-2-10-21)20(25)27-14-16-3-6-18(7-4-16)24-12-11-22-15-24/h3-8,11-13,15H,2,9-10,14H2,1H3 |
| InChIKey | BIZZWKOKBHYQBX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |