C23H26N4O2 — CID 166360657
[2-(2-hydroxyethyl)-4-methylpiperazin-1-yl]-[3-(5-phenylpyrazol-1-yl)phenyl]methanone (PubChem CID 166360657) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-methylpiperazin-1-yl]-[3-(5-phenylpyrazol-1-yl)phenyl]methanone.
| Compound Name | [2-(2-hydroxyethyl)-4-methylpiperazin-1-yl]-[3-(5-phenylpyrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 166360657 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-methylpiperazin-1-yl]-[3-(5-phenylpyrazol-1-yl)phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-n3nccc3-c3ccccc3)c2)C(CCO)C1 |
| InChI | InChI=1S/C23H26N4O2/c1-25-13-14-26(21(17-25)11-15-28)23(29)19-8-5-9-20(16-19)27-22(10-12-24-27)18-6-3-2-4-7-18/h2-10,12,16,21,28H,11,13-15,17H2,1H3 |
| InChIKey | HUBDDWXVJZIBCY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |