C18H18N4OS — CID 166360667
4-piperazin-1-yl-N-pyridin-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 166360667) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 4-piperazin-1-yl-N-pyridin-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 4-piperazin-1-yl-N-pyridin-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 166360667 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-piperazin-1-yl-N-pyridin-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc2c(N3CCNCC3)cccc2s1 |
| InChI | InChI=1S/C18H18N4OS/c23-18(21-17-6-1-2-7-20-17)16-12-13-14(4-3-5-15(13)24-16)22-10-8-19-9-11-22/h1-7,12,19H,8-11H2,(H,20,21,23) |
| InChIKey | ICWMLJYTGYHSAU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |