About 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine
1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine (PubChem CID 166361383) has the molecular formula C19H19N3S
and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine.
Molecular Properties
| Compound Name | 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine |
| PubChem CID | 166361383 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine |
| SMILES | NC1Cc2ccccc2N(Cc2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C19H19N3S/c20-16-10-15-8-4-5-9-18(15)22(11-16)12-19-21-17(13-23-19)14-6-2-1-3-7-14/h1-9,13,16H,10-12,20H2 |
| InChIKey | VSZIPPNFRAKCOP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine?
The IUPAC name of 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine (CID 166361383) is 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine.
What is the SMILES notation for 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine?
The canonical SMILES for 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine is NC1Cc2ccccc2N(Cc2nc(-c3ccccc3)cs2)C1.
What is the InChIKey of 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine?
The InChIKey is VSZIPPNFRAKCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3S/c20-16-10-15-8-4-5-9-18(15)22(11-16)12-19-21-17(13-23-19)14-6-2-1-3-7-14/h1-9,13,16H,10-12,20H2.
What are the key properties of 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine?
1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine has a molecular weight of 321.45 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-quinolin-3-amine is sourced from PubChem (CID 166361383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).