About [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine
[4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine (PubChem CID 166362506) has the molecular formula C15H14F2N4OS
and a molecular weight of 336.37 g/mol. Its IUPAC name is [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine |
| PubChem CID | 166362506 |
| Molecular Formula | C15H14F2N4OS |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine |
| SMILES | Cn1ncc(SCc2coc(-c3ccc(F)c(F)c3)n2)c1CN |
| InChI | InChI=1S/C15H14F2N4OS/c1-21-13(5-18)14(6-19-21)23-8-10-7-22-15(20-10)9-2-3-11(16)12(17)4-9/h2-4,6-7H,5,8,18H2,1H3 |
| InChIKey | XRWHJZFINLIZCU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine?
The IUPAC name of [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine (CID 166362506) is [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine.
What is the SMILES notation for [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine?
The canonical SMILES for [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine is Cn1ncc(SCc2coc(-c3ccc(F)c(F)c3)n2)c1CN.
What is the InChIKey of [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine?
The InChIKey is XRWHJZFINLIZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N4OS/c1-21-13(5-18)14(6-19-21)23-8-10-7-22-15(20-10)9-2-3-11(16)12(17)4-9/h2-4,6-7H,5,8,18H2,1H3.
What are the key properties of [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine?
[4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine has a molecular weight of 336.37 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2-(3,4-difluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1-methylpyrazol-5-yl]methanamine is sourced from PubChem (CID 166362506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).