About 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea
1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea (PubChem CID 166363175) has the molecular formula C16H17N5O2
and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea |
| PubChem CID | 166363175 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea |
| SMILES | Cc1nc2c(NC(=O)NCCNc3ccncc3)cccc2o1 |
| InChI | InChI=1S/C16H17N5O2/c1-11-20-15-13(3-2-4-14(15)23-11)21-16(22)19-10-9-18-12-5-7-17-8-6-12/h2-8H,9-10H2,1H3,(H,17,18)(H2,19,21,22) |
| InChIKey | OECZUZPTRYOBMS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea?
The IUPAC name of 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea (CID 166363175) is 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea.
What is the SMILES notation for 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea?
The canonical SMILES for 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea is Cc1nc2c(NC(=O)NCCNc3ccncc3)cccc2o1.
What is the InChIKey of 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea?
The InChIKey is OECZUZPTRYOBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O2/c1-11-20-15-13(3-2-4-14(15)23-11)21-16(22)19-10-9-18-12-5-7-17-8-6-12/h2-8H,9-10H2,1H3,(H,17,18)(H2,19,21,22).
What are the key properties of 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea?
1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea has a molecular weight of 311.35 g/mol, XLogP of 2.76, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-benzoxazol-4-yl)-3-[2-(pyridin-4-ylamino)ethyl]urea is sourced from PubChem (CID 166363175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).