C22H21F3N4O3 — CID 166363322
N-[(4-pyrazin-2-yloxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 166363322) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is N-[(4-pyrazin-2-yloxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4-pyrazin-2-yloxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166363322 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[(4-pyrazin-2-yloxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cnc(Oc2ccc(CNc3ccc4c(c3)CNCC4)cc2)cn1 |
| InChI | InChI=1S/C20H20N4O.C2HF3O2/c1-5-19(25-20-14-22-9-10-23-20)6-2-15(1)12-24-18-4-3-16-7-8-21-13-17(16)11-18;3-2(4,5)1(6)7/h1-6,9-11,14,21,24H,7-8,12-13H2;(H,6,7) |
| InChIKey | RNMMLKGIJJCFAV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |