C23H25N5 — CID 166363762
4-[[3-methyl-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 166363762) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is 4-[[3-methyl-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-methyl-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 166363762 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-[[3-methyl-4-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | CC1CN(Cc2ccc(C#N)cc2)CCN1Cc1cnc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H25N5/c1-18-15-27(16-20-9-7-19(13-24)8-10-20)11-12-28(18)17-22-14-25-23(26-22)21-5-3-2-4-6-21/h2-10,14,18H,11-12,15-17H2,1H3,(H,25,26) |
| InChIKey | JCYHATPDAZGBMW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |