C14H15BrN4S — CID 166364342
N-[(5-bromo-1-benzothiophen-2-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine (PubChem CID 166364342) has the molecular formula C14H15BrN4S and a molecular weight of 351.27 g/mol. Its IUPAC name is N-[(5-bromo-1-benzothiophen-2-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(5-bromo-1-benzothiophen-2-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 166364342 |
| Molecular Formula | C14H15BrN4S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N-[(5-bromo-1-benzothiophen-2-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cc1nc(CCNCc2cc3cc(Br)ccc3s2)n[nH]1 |
| InChI | InChI=1S/C14H15BrN4S/c1-9-17-14(19-18-9)4-5-16-8-12-7-10-6-11(15)2-3-13(10)20-12/h2-3,6-7,16H,4-5,8H2,1H3,(H,17,18,19) |
| InChIKey | DQRBDBPIBUGTEP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|