C18H20N4O — CID 166364494
1-methyl-5-[[1-(3-pyrazol-1-ylphenyl)ethylamino]methyl]pyridin-2-one (PubChem CID 166364494) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-methyl-5-[[1-(3-pyrazol-1-ylphenyl)ethylamino]methyl]pyridin-2-one.
| Compound Name | 1-methyl-5-[[1-(3-pyrazol-1-ylphenyl)ethylamino]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 166364494 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-methyl-5-[[1-(3-pyrazol-1-ylphenyl)ethylamino]methyl]pyridin-2-one |
| SMILES | CC(NCc1ccc(=O)n(C)c1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H20N4O/c1-14(19-12-15-7-8-18(23)21(2)13-15)16-5-3-6-17(11-16)22-10-4-9-20-22/h3-11,13-14,19H,12H2,1-2H3 |
| InChIKey | WGOSXXCBIXJPQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |