C17H13FN6O — CID 166364576
3-[[4-(6-amino-3-pyridinyl)triazol-1-yl]methyl]-7-fluoro-1H-quinolin-2-one (PubChem CID 166364576) has the molecular formula C17H13FN6O and a molecular weight of 336.33 g/mol. Its IUPAC name is 3-[[4-(6-amino-3-pyridinyl)triazol-1-yl]methyl]-7-fluoro-1H-quinolin-2-one.
| Compound Name | 3-[[4-(6-amino-3-pyridinyl)triazol-1-yl]methyl]-7-fluoro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166364576 |
| Molecular Formula | C17H13FN6O |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[[4-(6-amino-3-pyridinyl)triazol-1-yl]methyl]-7-fluoro-1H-quinolin-2-one |
| SMILES | Nc1ccc(-c2cn(Cc3cc4ccc(F)cc4[nH]c3=O)nn2)cn1 |
| InChI | InChI=1S/C17H13FN6O/c18-13-3-1-10-5-12(17(25)21-14(10)6-13)8-24-9-15(22-23-24)11-2-4-16(19)20-7-11/h1-7,9H,8H2,(H2,19,20)(H,21,25) |
| InChIKey | UDIJTHOPRSXHBI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |