C17H22N8O — CID 166364656
N-[[1-[(2S)-2-aminopropyl]triazol-4-yl]methyl]-4-[(1-methylpyrazol-3-yl)amino]benzamide (PubChem CID 166364656) has the molecular formula C17H22N8O and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[[1-[(2S)-2-aminopropyl]triazol-4-yl]methyl]-4-[(1-methylpyrazol-3-yl)amino]benzamide.
| Compound Name | N-[[1-[(2S)-2-aminopropyl]triazol-4-yl]methyl]-4-[(1-methylpyrazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 166364656 |
| Molecular Formula | C17H22N8O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[[1-[(2S)-2-aminopropyl]triazol-4-yl]methyl]-4-[(1-methylpyrazol-3-yl)amino]benzamide |
| SMILES | C[C@H](N)Cn1cc(CNC(=O)c2ccc(Nc3ccn(C)n3)cc2)nn1 |
| InChI | InChI=1S/C17H22N8O/c1-12(18)10-25-11-15(21-23-25)9-19-17(26)13-3-5-14(6-4-13)20-16-7-8-24(2)22-16/h3-8,11-12H,9-10,18H2,1-2H3,(H,19,26)(H,20,22)/t12-/m0/s1 |
| InChIKey | QBVZHXXFKIVAOH-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |