C16H23N5O2 — CID 166365569
N-[2-(2,2-dimethylpentanoylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide (PubChem CID 166365569) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpentanoylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(2,2-dimethylpentanoylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166365569 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[2-(2,2-dimethylpentanoylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
| SMILES | CCCC(C)(C)C(=O)NCCNC(=O)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C16H23N5O2/c1-4-6-16(2,3)15(23)19-9-8-18-14(22)12-11-5-7-17-13(11)21-10-20-12/h5,7,10H,4,6,8-9H2,1-3H3,(H,18,22)(H,19,23)(H,17,20,21) |
| InChIKey | VPPBEVIFUPWAAD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|